C22H19BrF9N3O4 — CID 139934361
ethyl 2-[2-bromo-N-[6-oxo-1-prop-2-enyl-4-(trifluoromethyl)pyrimidin-2-yl]-3,5-bis(trifluoromethyl)anilino]-2-ethoxyacetate (PubChem CID 139934361) has the molecular formula C22H19BrF9N3O4 and a molecular weight of 640.30 g/mol. Its IUPAC name is ethyl 2-[2-bromo-N-[6-oxo-1-prop-2-enyl-4-(trifluoromethyl)pyrimidin-2-yl]-3,5-bis(trifluoromethyl)anilino]-2-ethoxyacetate.
| Compound Name | ethyl 2-[2-bromo-N-[6-oxo-1-prop-2-enyl-4-(trifluoromethyl)pyrimidin-2-yl]-3,5-bis(trifluoromethyl)anilino]-2-ethoxyacetate |
|---|---|
| PubChem CID | 139934361 |
| Molecular Formula | C22H19BrF9N3O4 |
| Molecular Weight | 640.30 g/mol |
| Exact Mass | 639.04 |
| IUPAC Name | ethyl 2-[2-bromo-N-[6-oxo-1-prop-2-enyl-4-(trifluoromethyl)pyrimidin-2-yl]-3,5-bis(trifluoromethyl)anilino]-2-ethoxyacetate |
| SMILES | C=CCn1c(N(c2cc(C(F)(F)F)cc(C(F)(F)F)c2Br)C(OCC)C(=O)OCC)nc(C(F)(F)F)cc1=O |
| InChI | InChI=1S/C22H19BrF9N3O4/c1-4-7-34-15(36)10-14(22(30,31)32)33-19(34)35(17(38-5-2)18(37)39-6-3)13-9-11(20(24,25)26)8-12(16(13)23)21(27,28)29/h4,8-10,17H,1,5-7H2,2-3H3 |
| InChIKey | DNXCISGIYGHVKT-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.30 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|