C21H16Br2F9N3O4 — CID 139934438
ethyl 2-[2-bromo-N-[5-bromo-6-oxo-1-prop-2-enyl-4-(trifluoromethyl)pyrimidin-2-yl]-3,5-bis(trifluoromethyl)anilino]-2-methoxyacetate (PubChem CID 139934438) has the molecular formula C21H16Br2F9N3O4 and a molecular weight of 705.17 g/mol. Its IUPAC name is ethyl 2-[2-bromo-N-[5-bromo-6-oxo-1-prop-2-enyl-4-(trifluoromethyl)pyrimidin-2-yl]-3,5-bis(trifluoromethyl)anilino]-2-methoxyacetate.
| Compound Name | ethyl 2-[2-bromo-N-[5-bromo-6-oxo-1-prop-2-enyl-4-(trifluoromethyl)pyrimidin-2-yl]-3,5-bis(trifluoromethyl)anilino]-2-methoxyacetate |
|---|---|
| PubChem CID | 139934438 |
| Molecular Formula | C21H16Br2F9N3O4 |
| Molecular Weight | 705.17 g/mol |
| Exact Mass | 702.94 |
| IUPAC Name | ethyl 2-[2-bromo-N-[5-bromo-6-oxo-1-prop-2-enyl-4-(trifluoromethyl)pyrimidin-2-yl]-3,5-bis(trifluoromethyl)anilino]-2-methoxyacetate |
| SMILES | C=CCn1c(N(c2cc(C(F)(F)F)cc(C(F)(F)F)c2Br)C(OC)C(=O)OCC)nc(C(F)(F)F)c(Br)c1=O |
| InChI | InChI=1S/C21H16Br2F9N3O4/c1-4-6-34-15(36)13(23)14(21(30,31)32)33-18(34)35(16(38-3)17(37)39-5-2)11-8-9(19(24,25)26)7-10(12(11)22)20(27,28)29/h4,7-8,16H,1,5-6H2,2-3H3 |
| InChIKey | BTEUWMIRBJOACY-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.17 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|