C23H23ClFN3OS — CID 19642293
3-[(2-chloro-6-fluorophenyl)methylsulfanyl]-5-(4-cyclopentyloxyphenyl)-4-prop-2-enyl-1,2,4-triazole (PubChem CID 19642293) has the molecular formula C23H23ClFN3OS and a molecular weight of 443.98 g/mol. Its IUPAC name is 3-[(2-chloro-6-fluorophenyl)methylsulfanyl]-5-(4-cyclopentyloxyphenyl)-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-[(2-chloro-6-fluorophenyl)methylsulfanyl]-5-(4-cyclopentyloxyphenyl)-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 19642293 |
| Molecular Formula | C23H23ClFN3OS |
| Molecular Weight | 443.98 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 3-[(2-chloro-6-fluorophenyl)methylsulfanyl]-5-(4-cyclopentyloxyphenyl)-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(SCc2c(F)cccc2Cl)nnc1-c1ccc(OC2CCCC2)cc1 |
| InChI | InChI=1S/C23H23ClFN3OS/c1-2-14-28-22(16-10-12-18(13-11-16)29-17-6-3-4-7-17)26-27-23(28)30-15-19-20(24)8-5-9-21(19)25/h2,5,8-13,17H,1,3-4,6-7,14-15H2 |
| InChIKey | UJLNSFHXCOMYRS-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.98 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|