C23H24ClN5O2S — CID 19642388
N-(2-chloro-3-pyridinyl)-2-[[5-(4-cyclopentyloxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 19642388) has the molecular formula C23H24ClN5O2S and a molecular weight of 470.00 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-[[5-(4-cyclopentyloxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-[[5-(4-cyclopentyloxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 19642388 |
| Molecular Formula | C23H24ClN5O2S |
| Molecular Weight | 470.00 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-[[5-(4-cyclopentyloxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cccnc2Cl)nnc1-c1ccc(OC2CCCC2)cc1 |
| InChI | InChI=1S/C23H24ClN5O2S/c1-2-14-29-22(16-9-11-18(12-10-16)31-17-6-3-4-7-17)27-28-23(29)32-15-20(30)26-19-8-5-13-25-21(19)24/h2,5,8-13,17H,1,3-4,6-7,14-15H2,(H,26,30) |
| InChIKey | OEAIQGYXGRTZMH-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.00 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|