C18H13Cl4N3S — CID 19729282
3-(3,4-dichlorophenyl)-5-[(2,6-dichlorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole (PubChem CID 19729282) has the molecular formula C18H13Cl4N3S and a molecular weight of 445.20 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-5-[(2,6-dichlorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-(3,4-dichlorophenyl)-5-[(2,6-dichlorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 19729282 |
| Molecular Formula | C18H13Cl4N3S |
| Molecular Weight | 445.20 g/mol |
| Exact Mass | 442.96 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-5-[(2,6-dichlorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(SCc2c(Cl)cccc2Cl)nnc1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H13Cl4N3S/c1-2-8-25-17(11-6-7-15(21)16(22)9-11)23-24-18(25)26-10-12-13(19)4-3-5-14(12)20/h2-7,9H,1,8,10H2 |
| InChIKey | WGDCOWKTGLTACO-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.20 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|