C19H16Cl3N3OS — CID 17262974
3-(5-chloro-2-methoxyphenyl)-5-[(2,6-dichlorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole (PubChem CID 17262974) has the molecular formula C19H16Cl3N3OS and a molecular weight of 440.78 g/mol. Its IUPAC name is 3-(5-chloro-2-methoxyphenyl)-5-[(2,6-dichlorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-(5-chloro-2-methoxyphenyl)-5-[(2,6-dichlorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 17262974 |
| Molecular Formula | C19H16Cl3N3OS |
| Molecular Weight | 440.78 g/mol |
| Exact Mass | 439.01 |
| IUPAC Name | 3-(5-chloro-2-methoxyphenyl)-5-[(2,6-dichlorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(SCc2c(Cl)cccc2Cl)nnc1-c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C19H16Cl3N3OS/c1-3-9-25-18(13-10-12(20)7-8-17(13)26-2)23-24-19(25)27-11-14-15(21)5-4-6-16(14)22/h3-8,10H,1,9,11H2,2H3 |
| InChIKey | OBKSWQUDEGSSEJ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.78 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|