C19H19ClN4O3S — CID 17384028
2-[[5-(5-chloro-2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(furan-2-ylmethyl)acetamide (PubChem CID 17384028) has the molecular formula C19H19ClN4O3S and a molecular weight of 418.91 g/mol. Its IUPAC name is 2-[[5-(5-chloro-2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[[5-(5-chloro-2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 17384028 |
| Molecular Formula | C19H19ClN4O3S |
| Molecular Weight | 418.91 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 2-[[5-(5-chloro-2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(furan-2-ylmethyl)acetamide |
| SMILES | C=CCn1c(SCC(=O)NCc2ccco2)nnc1-c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C19H19ClN4O3S/c1-3-8-24-18(15-10-13(20)6-7-16(15)26-2)22-23-19(24)28-12-17(25)21-11-14-5-4-9-27-14/h3-7,9-10H,1,8,11-12H2,2H3,(H,21,25) |
| InChIKey | LKIXCIOUXAYGHT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.91 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|