C16H15ClN6O3S — CID 17266236
3-(5-chloro-2-methoxyphenyl)-5-[(4-nitropyrazol-1-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole (PubChem CID 17266236) has the molecular formula C16H15ClN6O3S and a molecular weight of 406.86 g/mol. Its IUPAC name is 3-(5-chloro-2-methoxyphenyl)-5-[(4-nitropyrazol-1-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-(5-chloro-2-methoxyphenyl)-5-[(4-nitropyrazol-1-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 17266236 |
| Molecular Formula | C16H15ClN6O3S |
| Molecular Weight | 406.86 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 3-(5-chloro-2-methoxyphenyl)-5-[(4-nitropyrazol-1-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(SCn2cc([N+](=O)[O-])cn2)nnc1-c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C16H15ClN6O3S/c1-3-6-22-15(13-7-11(17)4-5-14(13)26-2)19-20-16(22)27-10-21-9-12(8-18-21)23(24)25/h3-5,7-9H,1,6,10H2,2H3 |
| InChIKey | KRLGQGSATKCHOV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 100.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.86 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|