C15H12Cl2N6O2S — CID 17267044
3-(2,4-dichlorophenyl)-5-[(4-nitropyrazol-1-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole (PubChem CID 17267044) has the molecular formula C15H12Cl2N6O2S and a molecular weight of 411.27 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-5-[(4-nitropyrazol-1-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-(2,4-dichlorophenyl)-5-[(4-nitropyrazol-1-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 17267044 |
| Molecular Formula | C15H12Cl2N6O2S |
| Molecular Weight | 411.27 g/mol |
| Exact Mass | 410.01 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-5-[(4-nitropyrazol-1-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(SCn2cc([N+](=O)[O-])cn2)nnc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H12Cl2N6O2S/c1-2-5-22-14(12-4-3-10(16)6-13(12)17)19-20-15(22)26-9-21-8-11(7-18-21)23(24)25/h2-4,6-8H,1,5,9H2 |
| InChIKey | ULKCSYYDXXZUBH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 91.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.27 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|