C13H11BrN6O3S — CID 19724971
3-(5-bromofuran-2-yl)-5-[(4-nitropyrazol-1-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole (PubChem CID 19724971) has the molecular formula C13H11BrN6O3S and a molecular weight of 411.24 g/mol. Its IUPAC name is 3-(5-bromofuran-2-yl)-5-[(4-nitropyrazol-1-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-(5-bromofuran-2-yl)-5-[(4-nitropyrazol-1-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 19724971 |
| Molecular Formula | C13H11BrN6O3S |
| Molecular Weight | 411.24 g/mol |
| Exact Mass | 409.98 |
| IUPAC Name | 3-(5-bromofuran-2-yl)-5-[(4-nitropyrazol-1-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(SCn2cc([N+](=O)[O-])cn2)nnc1-c1ccc(Br)o1 |
| InChI | InChI=1S/C13H11BrN6O3S/c1-2-5-19-12(10-3-4-11(14)23-10)16-17-13(19)24-8-18-7-9(6-15-18)20(21)22/h2-4,6-7H,1,5,8H2 |
| InChIKey | QAUJUBFQYVRJRY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 104.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.24 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|