C17H24N6O2S — CID 17303407
3-(2-cyclohexylethyl)-5-[(4-nitropyrazol-1-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole (PubChem CID 17303407) has the molecular formula C17H24N6O2S and a molecular weight of 376.49 g/mol. Its IUPAC name is 3-(2-cyclohexylethyl)-5-[(4-nitropyrazol-1-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-(2-cyclohexylethyl)-5-[(4-nitropyrazol-1-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 17303407 |
| Molecular Formula | C17H24N6O2S |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 3-(2-cyclohexylethyl)-5-[(4-nitropyrazol-1-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(CCC2CCCCC2)nnc1SCn1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C17H24N6O2S/c1-2-10-22-16(9-8-14-6-4-3-5-7-14)19-20-17(22)26-13-21-12-15(11-18-21)23(24)25/h2,11-12,14H,1,3-10,13H2 |
| InChIKey | IKSCUBPGLUQQTB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 91.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|