C16H18N6O2S — CID 17266593
4-ethyl-3-[(4-nitropyrazol-1-yl)methylsulfanyl]-5-(2-phenylethyl)-1,2,4-triazole (PubChem CID 17266593) has the molecular formula C16H18N6O2S and a molecular weight of 358.43 g/mol. Its IUPAC name is 4-ethyl-3-[(4-nitropyrazol-1-yl)methylsulfanyl]-5-(2-phenylethyl)-1,2,4-triazole.
| Compound Name | 4-ethyl-3-[(4-nitropyrazol-1-yl)methylsulfanyl]-5-(2-phenylethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 17266593 |
| Molecular Formula | C16H18N6O2S |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 4-ethyl-3-[(4-nitropyrazol-1-yl)methylsulfanyl]-5-(2-phenylethyl)-1,2,4-triazole |
| SMILES | CCn1c(CCc2ccccc2)nnc1SCn1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C16H18N6O2S/c1-2-21-15(9-8-13-6-4-3-5-7-13)18-19-16(21)25-12-20-11-14(10-17-20)22(23)24/h3-7,10-11H,2,8-9,12H2,1H3 |
| InChIKey | VXHARCDCSHTXNV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 91.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|