C14H14N6O2S — CID 17264351
3-benzyl-4-methyl-5-[(4-nitropyrazol-1-yl)methylsulfanyl]-1,2,4-triazole (PubChem CID 17264351) has the molecular formula C14H14N6O2S and a molecular weight of 330.37 g/mol. Its IUPAC name is 3-benzyl-4-methyl-5-[(4-nitropyrazol-1-yl)methylsulfanyl]-1,2,4-triazole.
| Compound Name | 3-benzyl-4-methyl-5-[(4-nitropyrazol-1-yl)methylsulfanyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 17264351 |
| Molecular Formula | C14H14N6O2S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 3-benzyl-4-methyl-5-[(4-nitropyrazol-1-yl)methylsulfanyl]-1,2,4-triazole |
| SMILES | Cn1c(Cc2ccccc2)nnc1SCn1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C14H14N6O2S/c1-18-13(7-11-5-3-2-4-6-11)16-17-14(18)23-10-19-9-12(8-15-19)20(21)22/h2-6,8-9H,7,10H2,1H3 |
| InChIKey | YNCRMHVRLFQHLB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 91.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|