C15H15FN6O3S — CID 19640470
3-[1-(4-fluorophenoxy)ethyl]-4-methyl-5-[(4-nitropyrazol-1-yl)methylsulfanyl]-1,2,4-triazole (PubChem CID 19640470) has the molecular formula C15H15FN6O3S and a molecular weight of 378.39 g/mol. Its IUPAC name is 3-[1-(4-fluorophenoxy)ethyl]-4-methyl-5-[(4-nitropyrazol-1-yl)methylsulfanyl]-1,2,4-triazole.
| Compound Name | 3-[1-(4-fluorophenoxy)ethyl]-4-methyl-5-[(4-nitropyrazol-1-yl)methylsulfanyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 19640470 |
| Molecular Formula | C15H15FN6O3S |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 3-[1-(4-fluorophenoxy)ethyl]-4-methyl-5-[(4-nitropyrazol-1-yl)methylsulfanyl]-1,2,4-triazole |
| SMILES | CC(Oc1ccc(F)cc1)c1nnc(SCn2cc([N+](=O)[O-])cn2)n1C |
| InChI | InChI=1S/C15H15FN6O3S/c1-10(25-13-5-3-11(16)4-6-13)14-18-19-15(20(14)2)26-9-21-8-12(7-17-21)22(23)24/h3-8,10H,9H2,1-2H3 |
| InChIKey | LUBCJWVFKUJDPK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 100.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|