C19H22N6O3S — CID 17268863
3-[1-(4-ethylphenoxy)ethyl]-5-[(4-nitropyrazol-1-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole (PubChem CID 17268863) has the molecular formula C19H22N6O3S and a molecular weight of 414.49 g/mol. Its IUPAC name is 3-[1-(4-ethylphenoxy)ethyl]-5-[(4-nitropyrazol-1-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-[1-(4-ethylphenoxy)ethyl]-5-[(4-nitropyrazol-1-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 17268863 |
| Molecular Formula | C19H22N6O3S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 3-[1-(4-ethylphenoxy)ethyl]-5-[(4-nitropyrazol-1-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(SCn2cc([N+](=O)[O-])cn2)nnc1C(C)Oc1ccc(CC)cc1 |
| InChI | InChI=1S/C19H22N6O3S/c1-4-10-24-18(14(3)28-17-8-6-15(5-2)7-9-17)21-22-19(24)29-13-23-12-16(11-20-23)25(26)27/h4,6-9,11-12,14H,1,5,10,13H2,2-3H3 |
| InChIKey | KYVLONWWNCNXTJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 100.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|