C18H22N6O3S — CID 17307754
3-[1-(2,4-dimethylphenoxy)ethyl]-4-ethyl-5-[(4-nitropyrazol-1-yl)methylsulfanyl]-1,2,4-triazole (PubChem CID 17307754) has the molecular formula C18H22N6O3S and a molecular weight of 402.48 g/mol. Its IUPAC name is 3-[1-(2,4-dimethylphenoxy)ethyl]-4-ethyl-5-[(4-nitropyrazol-1-yl)methylsulfanyl]-1,2,4-triazole.
| Compound Name | 3-[1-(2,4-dimethylphenoxy)ethyl]-4-ethyl-5-[(4-nitropyrazol-1-yl)methylsulfanyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 17307754 |
| Molecular Formula | C18H22N6O3S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 3-[1-(2,4-dimethylphenoxy)ethyl]-4-ethyl-5-[(4-nitropyrazol-1-yl)methylsulfanyl]-1,2,4-triazole |
| SMILES | CCn1c(SCn2cc([N+](=O)[O-])cn2)nnc1C(C)Oc1ccc(C)cc1C |
| InChI | InChI=1S/C18H22N6O3S/c1-5-23-17(14(4)27-16-7-6-12(2)8-13(16)3)20-21-18(23)28-11-22-10-15(9-19-22)24(25)26/h6-10,14H,5,11H2,1-4H3 |
| InChIKey | ZCRWKOATOWMNDV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 100.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|