C20H21N5O3S — CID 7681615
2-[(5-benzyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-methyl-5-nitrophenyl)acetamide (PubChem CID 7681615) has the molecular formula C20H21N5O3S and a molecular weight of 411.49 g/mol. Its IUPAC name is 2-[(5-benzyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-methyl-5-nitrophenyl)acetamide.
| Compound Name | 2-[(5-benzyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-methyl-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 7681615 |
| Molecular Formula | C20H21N5O3S |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 2-[(5-benzyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-methyl-5-nitrophenyl)acetamide |
| SMILES | CCn1c(Cc2ccccc2)nnc1SCC(=O)Nc1cc([N+](=O)[O-])ccc1C |
| InChI | InChI=1S/C20H21N5O3S/c1-3-24-18(11-15-7-5-4-6-8-15)22-23-20(24)29-13-19(26)21-17-12-16(25(27)28)10-9-14(17)2/h4-10,12H,3,11,13H2,1-2H3,(H,21,26) |
| InChIKey | FHFFZCHZFXEFPZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|