C24H29N5O4S — CID 2205368
2-[[4-ethyl-5-[3-(4-methoxy-3-methylphenyl)propyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methyl-5-nitrophenyl)acetamide (PubChem CID 2205368) has the molecular formula C24H29N5O4S and a molecular weight of 483.59 g/mol. Its IUPAC name is 2-[[4-ethyl-5-[3-(4-methoxy-3-methylphenyl)propyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methyl-5-nitrophenyl)acetamide.
| Compound Name | 2-[[4-ethyl-5-[3-(4-methoxy-3-methylphenyl)propyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methyl-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 2205368 |
| Molecular Formula | C24H29N5O4S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | 2-[[4-ethyl-5-[3-(4-methoxy-3-methylphenyl)propyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methyl-5-nitrophenyl)acetamide |
| SMILES | CCn1c(CCCc2ccc(OC)c(C)c2)nnc1SCC(=O)Nc1cc([N+](=O)[O-])ccc1C |
| InChI | InChI=1S/C24H29N5O4S/c1-5-28-22(8-6-7-18-10-12-21(33-4)17(3)13-18)26-27-24(28)34-15-23(30)25-20-14-19(29(31)32)11-9-16(20)2/h9-14H,5-8,15H2,1-4H3,(H,25,30) |
| InChIKey | DGXGXWSERPWZGZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|