C23H26N6O5S — CID 3504040
N-(4-ethoxyphenyl)-2-[4-ethyl-5-[2-(2-methyl-5-nitroanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]acetamide (PubChem CID 3504040) has the molecular formula C23H26N6O5S and a molecular weight of 498.57 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-[4-ethyl-5-[2-(2-methyl-5-nitroanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]acetamide.
| Compound Name | N-(4-ethoxyphenyl)-2-[4-ethyl-5-[2-(2-methyl-5-nitroanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]acetamide |
|---|---|
| PubChem CID | 3504040 |
| Molecular Formula | C23H26N6O5S |
| Molecular Weight | 498.57 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-[4-ethyl-5-[2-(2-methyl-5-nitroanilino)-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]acetamide |
| SMILES | CCOc1ccc(NC(=O)Cc2nnc(SCC(=O)Nc3cc([N+](=O)[O-])ccc3C)n2CC)cc1 |
| InChI | InChI=1S/C23H26N6O5S/c1-4-28-20(13-21(30)24-16-7-10-18(11-8-16)34-5-2)26-27-23(28)35-14-22(31)25-19-12-17(29(32)33)9-6-15(19)3/h6-12H,4-5,13-14H2,1-3H3,(H,24,30)(H,25,31) |
| InChIKey | LTTJIWAOQPPDCU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 141.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|