C16H13BrClN3OS — CID 19724843
3-(5-bromofuran-2-yl)-5-[(4-chlorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole (PubChem CID 19724843) has the molecular formula C16H13BrClN3OS and a molecular weight of 410.72 g/mol. Its IUPAC name is 3-(5-bromofuran-2-yl)-5-[(4-chlorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-(5-bromofuran-2-yl)-5-[(4-chlorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 19724843 |
| Molecular Formula | C16H13BrClN3OS |
| Molecular Weight | 410.72 g/mol |
| Exact Mass | 408.97 |
| IUPAC Name | 3-(5-bromofuran-2-yl)-5-[(4-chlorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(SCc2ccc(Cl)cc2)nnc1-c1ccc(Br)o1 |
| InChI | InChI=1S/C16H13BrClN3OS/c1-2-9-21-15(13-7-8-14(17)22-13)19-20-16(21)23-10-11-3-5-12(18)6-4-11/h2-8H,1,9-10H2 |
| InChIKey | YKXSYMACQGGGOO-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.72 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|