C20H16BrN3OS — CID 18284850
4-benzyl-3-benzylsulfanyl-5-(5-bromofuran-2-yl)-1,2,4-triazole (PubChem CID 18284850) has the molecular formula C20H16BrN3OS and a molecular weight of 426.34 g/mol. Its IUPAC name is 4-benzyl-3-benzylsulfanyl-5-(5-bromofuran-2-yl)-1,2,4-triazole.
| Compound Name | 4-benzyl-3-benzylsulfanyl-5-(5-bromofuran-2-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 18284850 |
| Molecular Formula | C20H16BrN3OS |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | 4-benzyl-3-benzylsulfanyl-5-(5-bromofuran-2-yl)-1,2,4-triazole |
| SMILES | Brc1ccc(-c2nnc(SCc3ccccc3)n2Cc2ccccc2)o1 |
| InChI | InChI=1S/C20H16BrN3OS/c21-18-12-11-17(25-18)19-22-23-20(26-14-16-9-5-2-6-10-16)24(19)13-15-7-3-1-4-8-15/h1-12H,13-14H2 |
| InChIKey | GTKQJMMHQMOULG-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |