C11H14Cl2OS — CID 107091780
3-[(2,3-dichlorophenyl)methylsulfanyl]butan-1-ol (PubChem CID 107091780) has the molecular formula C11H14Cl2OS and a molecular weight of 265.20 g/mol. Its IUPAC name is 3-[(2,3-dichlorophenyl)methylsulfanyl]butan-1-ol.
| Compound Name | 3-[(2,3-dichlorophenyl)methylsulfanyl]butan-1-ol |
|---|---|
| PubChem CID | 107091780 |
| Molecular Formula | C11H14Cl2OS |
| Molecular Weight | 265.20 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | 3-[(2,3-dichlorophenyl)methylsulfanyl]butan-1-ol |
| SMILES | CC(CCO)SCc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C11H14Cl2OS/c1-8(5-6-14)15-7-9-3-2-4-10(12)11(9)13/h2-4,8,14H,5-7H2,1H3 |
| InChIKey | XIFIURRKGNTMAL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.20 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |