C14H21Cl2NO — CID 107093336
3-[(2,3-dichlorophenyl)methylamino]-4,4-dimethylpentan-1-ol (PubChem CID 107093336) has the molecular formula C14H21Cl2NO and a molecular weight of 290.23 g/mol. Its IUPAC name is 3-[(2,3-dichlorophenyl)methylamino]-4,4-dimethylpentan-1-ol.
| Compound Name | 3-[(2,3-dichlorophenyl)methylamino]-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 107093336 |
| Molecular Formula | C14H21Cl2NO |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 3-[(2,3-dichlorophenyl)methylamino]-4,4-dimethylpentan-1-ol |
| SMILES | CC(C)(C)C(CCO)NCc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H21Cl2NO/c1-14(2,3)12(7-8-18)17-9-10-5-4-6-11(15)13(10)16/h4-6,12,17-18H,7-9H2,1-3H3 |
| InChIKey | QAXOXVAFGWPKKT-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |