C12H17Cl2NO — CID 115644707
3-[(2,3-dichlorophenyl)methylamino]pentan-1-ol (PubChem CID 115644707) has the molecular formula C12H17Cl2NO and a molecular weight of 262.18 g/mol. Its IUPAC name is 3-[(2,3-dichlorophenyl)methylamino]pentan-1-ol.
| Compound Name | 3-[(2,3-dichlorophenyl)methylamino]pentan-1-ol |
|---|---|
| PubChem CID | 115644707 |
| Molecular Formula | C12H17Cl2NO |
| Molecular Weight | 262.18 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 3-[(2,3-dichlorophenyl)methylamino]pentan-1-ol |
| SMILES | CCC(CCO)NCc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C12H17Cl2NO/c1-2-10(6-7-16)15-8-9-4-3-5-11(13)12(9)14/h3-5,10,15-16H,2,6-8H2,1H3 |
| InChIKey | NTUJUPZVWSLBAG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.18 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |