C10H14ClNOS — CID 66138366
3-[(3-chloro-4-pyridinyl)methylsulfanyl]butan-1-ol (PubChem CID 66138366) has the molecular formula C10H14ClNOS and a molecular weight of 231.75 g/mol. Its IUPAC name is 3-[(3-chloro-4-pyridinyl)methylsulfanyl]butan-1-ol.
| Compound Name | 3-[(3-chloro-4-pyridinyl)methylsulfanyl]butan-1-ol |
|---|---|
| PubChem CID | 66138366 |
| Molecular Formula | C10H14ClNOS |
| Molecular Weight | 231.75 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 3-[(3-chloro-4-pyridinyl)methylsulfanyl]butan-1-ol |
| SMILES | CC(CCO)SCc1ccncc1Cl |
| InChI | InChI=1S/C10H14ClNOS/c1-8(3-5-13)14-7-9-2-4-12-6-10(9)11/h2,4,6,8,13H,3,5,7H2,1H3 |
| InChIKey | IMUURVGJYAPLNL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.75 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |