C10H13Cl2NOS — CID 116519689
3-[(4,6-dichloro-3-pyridinyl)methylsulfanyl]butan-1-ol (PubChem CID 116519689) has the molecular formula C10H13Cl2NOS and a molecular weight of 266.19 g/mol. Its IUPAC name is 3-[(4,6-dichloro-3-pyridinyl)methylsulfanyl]butan-1-ol.
| Compound Name | 3-[(4,6-dichloro-3-pyridinyl)methylsulfanyl]butan-1-ol |
|---|---|
| PubChem CID | 116519689 |
| Molecular Formula | C10H13Cl2NOS |
| Molecular Weight | 266.19 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 3-[(4,6-dichloro-3-pyridinyl)methylsulfanyl]butan-1-ol |
| SMILES | CC(CCO)SCc1cnc(Cl)cc1Cl |
| InChI | InChI=1S/C10H13Cl2NOS/c1-7(2-3-14)15-6-8-5-13-10(12)4-9(8)11/h4-5,7,14H,2-3,6H2,1H3 |
| InChIKey | IHRXJZQAONSJIS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.19 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|