About dideuterio-(4,6-dichloro-3-pyridinyl)methanol
dideuterio-(4,6-dichloro-3-pyridinyl)methanol (PubChem CID 171364953) has the molecular formula C6H5Cl2NO
and a molecular weight of 180.03 g/mol. Its IUPAC name is dideuterio-(4,6-dichloro-3-pyridinyl)methanol.
Molecular Properties
| Compound Name | dideuterio-(4,6-dichloro-3-pyridinyl)methanol |
| PubChem CID | 171364953 |
| Molecular Formula | C6H5Cl2NO |
| Molecular Weight | 180.03 g/mol |
| Exact Mass | 178.99 |
| IUPAC Name | dideuterio-(4,6-dichloro-3-pyridinyl)methanol |
| SMILES | [2H]C([2H])(O)c1cnc(Cl)cc1Cl |
| InChI | InChI=1S/C6H5Cl2NO/c7-5-1-6(8)9-2-4(5)3-10/h1-2,10H,3H2/i3D2 |
| InChIKey | VDXWCRIARMBDOX-SMZGMGDZSA-N |
| XLogP | 1.88 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.03 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze dideuterio-(4,6-dichloro-3-pyridinyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dideuterio-(4,6-dichloro-3-pyridinyl)methanol?
The IUPAC name of dideuterio-(4,6-dichloro-3-pyridinyl)methanol (CID 171364953) is dideuterio-(4,6-dichloro-3-pyridinyl)methanol.
What is the SMILES notation for dideuterio-(4,6-dichloro-3-pyridinyl)methanol?
The canonical SMILES for dideuterio-(4,6-dichloro-3-pyridinyl)methanol is [2H]C([2H])(O)c1cnc(Cl)cc1Cl.
What is the InChIKey of dideuterio-(4,6-dichloro-3-pyridinyl)methanol?
The InChIKey is VDXWCRIARMBDOX-SMZGMGDZSA-N. The full InChI is InChI=1S/C6H5Cl2NO/c7-5-1-6(8)9-2-4(5)3-10/h1-2,10H,3H2/i3D2.
What are the key properties of dideuterio-(4,6-dichloro-3-pyridinyl)methanol?
dideuterio-(4,6-dichloro-3-pyridinyl)methanol has a molecular weight of 180.03 g/mol, XLogP of 1.88, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dideuterio-(4,6-dichloro-3-pyridinyl)methanol is sourced from PubChem (CID 171364953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).