C6H5Cl2NO — CID 171364953
dideuterio-(4,6-dichloro-3-pyridinyl)methanol (PubChem CID 171364953) has the molecular formula C6H5Cl2NO and a molecular weight of 180.03 g/mol. Its IUPAC name is dideuterio-(4,6-dichloro-3-pyridinyl)methanol.
| Compound Name | dideuterio-(4,6-dichloro-3-pyridinyl)methanol |
|---|---|
| PubChem CID | 171364953 |
| Molecular Formula | C6H5Cl2NO |
| Molecular Weight | 180.03 g/mol |
| Exact Mass | 178.99 |
| IUPAC Name | dideuterio-(4,6-dichloro-3-pyridinyl)methanol |
| SMILES | [2H]C([2H])(O)c1cnc(Cl)cc1Cl |
| InChI | InChI=1S/C6H5Cl2NO/c7-5-1-6(8)9-2-4(5)3-10/h1-2,10H,3H2/i3D2 |
| InChIKey | VDXWCRIARMBDOX-SMZGMGDZSA-N |
| XLogP | 1.88 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.03 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|