C12H14Cl2N2O3S — CID 116519544
2-acetamido-4-[(4,6-dichloro-3-pyridinyl)methylsulfanyl]butanoic acid (PubChem CID 116519544) has the molecular formula C12H14Cl2N2O3S and a molecular weight of 337.23 g/mol. Its IUPAC name is 2-acetamido-4-[(4,6-dichloro-3-pyridinyl)methylsulfanyl]butanoic acid.
| Compound Name | 2-acetamido-4-[(4,6-dichloro-3-pyridinyl)methylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 116519544 |
| Molecular Formula | C12H14Cl2N2O3S |
| Molecular Weight | 337.23 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | 2-acetamido-4-[(4,6-dichloro-3-pyridinyl)methylsulfanyl]butanoic acid |
| SMILES | CC(=O)NC(CCSCc1cnc(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C12H14Cl2N2O3S/c1-7(17)16-10(12(18)19)2-3-20-6-8-5-15-11(14)4-9(8)13/h4-5,10H,2-3,6H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | OJEIVZSDRWLHRZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|