C14H20ClN3O4S — CID 103054943
4-[(5-chloropyrazin-2-yl)methylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (PubChem CID 103054943) has the molecular formula C14H20ClN3O4S and a molecular weight of 361.85 g/mol. Its IUPAC name is 4-[(5-chloropyrazin-2-yl)methylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid.
| Compound Name | 4-[(5-chloropyrazin-2-yl)methylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
|---|---|
| PubChem CID | 103054943 |
| Molecular Formula | C14H20ClN3O4S |
| Molecular Weight | 361.85 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 4-[(5-chloropyrazin-2-yl)methylsulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(CCSCc1cnc(Cl)cn1)C(=O)O |
| InChI | InChI=1S/C14H20ClN3O4S/c1-14(2,3)22-13(21)18-10(12(19)20)4-5-23-8-9-6-17-11(15)7-16-9/h6-7,10H,4-5,8H2,1-3H3,(H,18,21)(H,19,20) |
| InChIKey | MJGAVVNITAOSTI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.85 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|