C10H12BrNO3S — CID 103224265
2-(2-amino-4-bromophenyl)sulfanyl-3-methoxypropanoic acid (PubChem CID 103224265) has the molecular formula C10H12BrNO3S and a molecular weight of 306.18 g/mol. Its IUPAC name is 2-(2-amino-4-bromophenyl)sulfanyl-3-methoxypropanoic acid.
| Compound Name | 2-(2-amino-4-bromophenyl)sulfanyl-3-methoxypropanoic acid |
|---|---|
| PubChem CID | 103224265 |
| Molecular Formula | C10H12BrNO3S |
| Molecular Weight | 306.18 g/mol |
| Exact Mass | 304.97 |
| IUPAC Name | 2-(2-amino-4-bromophenyl)sulfanyl-3-methoxypropanoic acid |
| SMILES | COCC(Sc1ccc(Br)cc1N)C(=O)O |
| InChI | InChI=1S/C10H12BrNO3S/c1-15-5-9(10(13)14)16-8-3-2-6(11)4-7(8)12/h2-4,9H,5,12H2,1H3,(H,13,14) |
| InChIKey | DXCDGFOVLJAWDT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.18 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|