C16H21N3OS — CID 118409311
S-[2-methyl-4-(3,4,5-trimethylpyrazol-1-yl)phenyl] N,N-dimethylcarbamothioate (PubChem CID 118409311) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is S-[2-methyl-4-(3,4,5-trimethylpyrazol-1-yl)phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[2-methyl-4-(3,4,5-trimethylpyrazol-1-yl)phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 118409311 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | S-[2-methyl-4-(3,4,5-trimethylpyrazol-1-yl)phenyl] N,N-dimethylcarbamothioate |
| SMILES | Cc1cc(-n2nc(C)c(C)c2C)ccc1SC(=O)N(C)C |
| InChI | InChI=1S/C16H21N3OS/c1-10-9-14(19-13(4)11(2)12(3)17-19)7-8-15(10)21-16(20)18(5)6/h7-9H,1-6H3 |
| InChIKey | IDRLHRCMQBUKCO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|