C17H16N2OS2 — CID 142739290
S-[[7-(4-methylphenyl)-1,2-benzothiazol-6-yl]] N,N-dimethylcarbamothioate (PubChem CID 142739290) has the molecular formula C17H16N2OS2 and a molecular weight of 328.46 g/mol. Its IUPAC name is S-[[7-(4-methylphenyl)-1,2-benzothiazol-6-yl]] N,N-dimethylcarbamothioate.
| Compound Name | S-[[7-(4-methylphenyl)-1,2-benzothiazol-6-yl]] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 142739290 |
| Molecular Formula | C17H16N2OS2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | S-[[7-(4-methylphenyl)-1,2-benzothiazol-6-yl]] N,N-dimethylcarbamothioate |
| SMILES | Cc1ccc(-c2c(SC(=O)N(C)C)ccc3cnsc23)cc1 |
| InChI | InChI=1S/C17H16N2OS2/c1-11-4-6-12(7-5-11)15-14(21-17(20)19(2)3)9-8-13-10-18-22-16(13)15/h4-10H,1-3H3 |
| InChIKey | JYNPSAXAQTUWNJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|