C13H15N3O2S2 — CID 59269143
S-[[5-[(4-methylphenyl)methoxy]-1,2,4-thiadiazol-3-yl]] N,N-dimethylcarbamothioate (PubChem CID 59269143) has the molecular formula C13H15N3O2S2 and a molecular weight of 309.42 g/mol. Its IUPAC name is S-[[5-[(4-methylphenyl)methoxy]-1,2,4-thiadiazol-3-yl]] N,N-dimethylcarbamothioate.
| Compound Name | S-[[5-[(4-methylphenyl)methoxy]-1,2,4-thiadiazol-3-yl]] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 59269143 |
| Molecular Formula | C13H15N3O2S2 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | S-[[5-[(4-methylphenyl)methoxy]-1,2,4-thiadiazol-3-yl]] N,N-dimethylcarbamothioate |
| SMILES | Cc1ccc(COc2nc(SC(=O)N(C)C)ns2)cc1 |
| InChI | InChI=1S/C13H15N3O2S2/c1-9-4-6-10(7-5-9)8-18-12-14-11(15-20-12)19-13(17)16(2)3/h4-7H,8H2,1-3H3 |
| InChIKey | CPRGDHMZQDPQQM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|