C16H12N2O3S — CID 155391788
5-[(4-phenylphenyl)methoxy]-1,2,4-thiadiazole-3-carboxylic acid (PubChem CID 155391788) has the molecular formula C16H12N2O3S and a molecular weight of 312.35 g/mol. Its IUPAC name is 5-[(4-phenylphenyl)methoxy]-1,2,4-thiadiazole-3-carboxylic acid.
| Compound Name | 5-[(4-phenylphenyl)methoxy]-1,2,4-thiadiazole-3-carboxylic acid |
|---|---|
| PubChem CID | 155391788 |
| Molecular Formula | C16H12N2O3S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 5-[(4-phenylphenyl)methoxy]-1,2,4-thiadiazole-3-carboxylic acid |
| SMILES | O=C(O)c1nsc(OCc2ccc(-c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C16H12N2O3S/c19-15(20)14-17-16(22-18-14)21-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9H,10H2,(H,19,20) |
| InChIKey | DUQLHVSBOOXJBQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |