5-[(4-phenylphenyl)methoxy]furan-3-carboxylic acid

C18H14O4 — CID 155391808

IUPAC5-[(4-phenylphenyl)methoxy]furan-3-carboxylic acid
SMILESO=C(O)c1coc(OCc2ccc(-c3ccccc3)cc2)c1
InChIInChI=1S/C18H14O4/c19-18(20)16-10-17(22-12-16)21-11-13-6-8-15(9-7-13)14-4-2-1-3-5-14/h1-10,12H,11H2,(H,19,20)
InChIKeyWNXRLEMYMBIBAU-UHFFFAOYSA-N
MW294.31 g/mol
LogP4.22
Rot. Bonds5

About 5-[(4-phenylphenyl)methoxy]furan-3-carboxylic acid

5-[(4-phenylphenyl)methoxy]furan-3-carboxylic acid (PubChem CID 155391808) has the molecular formula C18H14O4 and a molecular weight of 294.31 g/mol. Its IUPAC name is 5-[(4-phenylphenyl)methoxy]furan-3-carboxylic acid.

Molecular Properties

Compound Name5-[(4-phenylphenyl)methoxy]furan-3-carboxylic acid
PubChem CID155391808
Molecular FormulaC18H14O4
Molecular Weight294.31 g/mol
Exact Mass294.09
IUPAC Name5-[(4-phenylphenyl)methoxy]furan-3-carboxylic acid
SMILESO=C(O)c1coc(OCc2ccc(-c3ccccc3)cc2)c1
InChIInChI=1S/C18H14O4/c19-18(20)16-10-17(22-12-16)21-11-13-6-8-15(9-7-13)14-4-2-1-3-5-14/h1-10,12H,11H2,(H,19,20)
InChIKeyWNXRLEMYMBIBAU-UHFFFAOYSA-N
XLogP4.22
TPSA59.67 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500294.31
LogP ≤ 54.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-[(4-phenylphenyl)methoxy]furan-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-[(4-phenylphenoxy)methyl]benzoic acid
CID 18707489
2-[(4-phenylphenyl)methoxy]benzamide
CID 8011325
4-(2-phenylmethoxyphenyl)furan-2-carboxylic acid
CID 23062503
2-[4-[(2-bromo-4-phenylphenoxy)methyl]phenyl]acetic acid
CID 22682634
(4-phenylphenyl)methyl carbamate
CID 123751479
4-[4-(hydroperoxymethyl)phenyl]benzoic acid
CID 23562064
4-[(6-phenyl-2,3-dihydro-1H-inden-5-yl)oxymethyl]benzoic acid
CID 155520617
5-[(2-ethylphenoxy)methyl]furan-3-carboxylic acid
CID 55055885
4-[(4-phenylphenoxy)methyl]benzohydrazide
CID 2368822
5-[(2-cyanophenoxy)methyl]furan-3-carboxylic acid
CID 62269373
4-phenylmethoxybenzoic acid
CID 68896574
5-[(4-phenylphenyl)methoxymethyl]-1,2-oxazole-3-carboxylic acid
CID 118536656

Frequently Asked Questions

What is the IUPAC name of 5-[(4-phenylphenyl)methoxy]furan-3-carboxylic acid?
The IUPAC name of 5-[(4-phenylphenyl)methoxy]furan-3-carboxylic acid (CID 155391808) is 5-[(4-phenylphenyl)methoxy]furan-3-carboxylic acid.
What is the SMILES notation for 5-[(4-phenylphenyl)methoxy]furan-3-carboxylic acid?
The canonical SMILES for 5-[(4-phenylphenyl)methoxy]furan-3-carboxylic acid is O=C(O)c1coc(OCc2ccc(-c3ccccc3)cc2)c1.
What is the InChIKey of 5-[(4-phenylphenyl)methoxy]furan-3-carboxylic acid?
The InChIKey is WNXRLEMYMBIBAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14O4/c19-18(20)16-10-17(22-12-16)21-11-13-6-8-15(9-7-13)14-4-2-1-3-5-14/h1-10,12H,11H2,(H,19,20).
What are the key properties of 5-[(4-phenylphenyl)methoxy]furan-3-carboxylic acid?
5-[(4-phenylphenyl)methoxy]furan-3-carboxylic acid has a molecular weight of 294.31 g/mol, XLogP of 4.22, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4-phenylphenyl)methoxy]furan-3-carboxylic acid is sourced from PubChem (CID 155391808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).