C14H19N3O — CID 166473497
ethane;2-[(4-methylphenyl)methoxy]pyrimidin-4-amine (PubChem CID 166473497) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is ethane;2-[(4-methylphenyl)methoxy]pyrimidin-4-amine.
| Compound Name | ethane;2-[(4-methylphenyl)methoxy]pyrimidin-4-amine |
|---|---|
| PubChem CID | 166473497 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | ethane;2-[(4-methylphenyl)methoxy]pyrimidin-4-amine |
| SMILES | CC.Cc1ccc(COc2nccc(N)n2)cc1 |
| InChI | InChI=1S/C12H13N3O.C2H6/c1-9-2-4-10(5-3-9)8-16-12-14-7-6-11(13)15-12;1-2/h2-7H,8H2,1H3,(H2,13,14,15);1-2H3 |
| InChIKey | IRLBUENCTBBONZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |