C10H11NO2S — CID 122232724
S-(7-oxocyclohepta-1,3,5-trien-1-yl) N,N-dimethylcarbamothioate (PubChem CID 122232724) has the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. Its IUPAC name is S-(7-oxocyclohepta-1,3,5-trien-1-yl) N,N-dimethylcarbamothioate.
| Compound Name | S-(7-oxocyclohepta-1,3,5-trien-1-yl) N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 122232724 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | S-(7-oxocyclohepta-1,3,5-trien-1-yl) N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=O)Sc1cccccc1=O |
| InChI | InChI=1S/C10H11NO2S/c1-11(2)10(13)14-9-7-5-3-4-6-8(9)12/h3-7H,1-2H3 |
| InChIKey | NMPNTGFZHZGMDV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|