C21H26N2O2S — CID 56576978
S-[2-[[2-[4-(2-methylpropyl)phenyl]acetyl]amino]phenyl] N,N-dimethylcarbamothioate (PubChem CID 56576978) has the molecular formula C21H26N2O2S and a molecular weight of 370.52 g/mol. Its IUPAC name is S-[2-[[2-[4-(2-methylpropyl)phenyl]acetyl]amino]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[2-[[2-[4-(2-methylpropyl)phenyl]acetyl]amino]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 56576978 |
| Molecular Formula | C21H26N2O2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | S-[2-[[2-[4-(2-methylpropyl)phenyl]acetyl]amino]phenyl] N,N-dimethylcarbamothioate |
| SMILES | CC(C)Cc1ccc(CC(=O)Nc2ccccc2SC(=O)N(C)C)cc1 |
| InChI | InChI=1S/C21H26N2O2S/c1-15(2)13-16-9-11-17(12-10-16)14-20(24)22-18-7-5-6-8-19(18)26-21(25)23(3)4/h5-12,15H,13-14H2,1-4H3,(H,22,24) |
| InChIKey | YSKHQERTSISRSG-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|