C10H10F3NOS — CID 14795411
S-[2-(trifluoromethyl)phenyl] N,N-dimethylcarbamothioate (PubChem CID 14795411) has the molecular formula C10H10F3NOS and a molecular weight of 249.26 g/mol. Its IUPAC name is S-[2-(trifluoromethyl)phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[2-(trifluoromethyl)phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 14795411 |
| Molecular Formula | C10H10F3NOS |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | S-[2-(trifluoromethyl)phenyl] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=O)Sc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C10H10F3NOS/c1-14(2)9(15)16-8-6-4-3-5-7(8)10(11,12)13/h3-6H,1-2H3 |
| InChIKey | RJRJJFQIILDNLJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|