C15H25NOS — CID 64928528
4-(2,4-dimethylphenyl)sulfanyl-3-(propylamino)butan-1-ol (PubChem CID 64928528) has the molecular formula C15H25NOS and a molecular weight of 267.44 g/mol. Its IUPAC name is 4-(2,4-dimethylphenyl)sulfanyl-3-(propylamino)butan-1-ol.
| Compound Name | 4-(2,4-dimethylphenyl)sulfanyl-3-(propylamino)butan-1-ol |
|---|---|
| PubChem CID | 64928528 |
| Molecular Formula | C15H25NOS |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 4-(2,4-dimethylphenyl)sulfanyl-3-(propylamino)butan-1-ol |
| SMILES | CCCNC(CCO)CSc1ccc(C)cc1C |
| InChI | InChI=1S/C15H25NOS/c1-4-8-16-14(7-9-17)11-18-15-6-5-12(2)10-13(15)3/h5-6,10,14,16-17H,4,7-9,11H2,1-3H3 |
| InChIKey | AEGFOGDQOGWNKB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |