C14H11Cl3S — CID 12507907
1,2-dichloro-4-[[2-(chloromethyl)phenyl]sulfanylmethyl]benzene (PubChem CID 12507907) has the molecular formula C14H11Cl3S and a molecular weight of 317.67 g/mol. Its IUPAC name is 1,2-dichloro-4-[[2-(chloromethyl)phenyl]sulfanylmethyl]benzene.
| Compound Name | 1,2-dichloro-4-[[2-(chloromethyl)phenyl]sulfanylmethyl]benzene |
|---|---|
| PubChem CID | 12507907 |
| Molecular Formula | C14H11Cl3S |
| Molecular Weight | 317.67 g/mol |
| Exact Mass | 315.96 |
| IUPAC Name | 1,2-dichloro-4-[[2-(chloromethyl)phenyl]sulfanylmethyl]benzene |
| SMILES | ClCc1ccccc1SCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H11Cl3S/c15-8-11-3-1-2-4-14(11)18-9-10-5-6-12(16)13(17)7-10/h1-7H,8-9H2 |
| InChIKey | LOZCIVRJQZXLLA-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.67 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|