C21H28O3S — CID 70967264
4-[2-butoxy-3-(4-methylphenoxy)propyl]sulfanyl-2-methylphenol (PubChem CID 70967264) has the molecular formula C21H28O3S and a molecular weight of 360.52 g/mol. Its IUPAC name is 4-[2-butoxy-3-(4-methylphenoxy)propyl]sulfanyl-2-methylphenol.
| Compound Name | 4-[2-butoxy-3-(4-methylphenoxy)propyl]sulfanyl-2-methylphenol |
|---|---|
| PubChem CID | 70967264 |
| Molecular Formula | C21H28O3S |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 4-[2-butoxy-3-(4-methylphenoxy)propyl]sulfanyl-2-methylphenol |
| SMILES | CCCCOC(COc1ccc(C)cc1)CSc1ccc(O)c(C)c1 |
| InChI | InChI=1S/C21H28O3S/c1-4-5-12-23-19(14-24-18-8-6-16(2)7-9-18)15-25-20-10-11-21(22)17(3)13-20/h6-11,13,19,22H,4-5,12,14-15H2,1-3H3 |
| InChIKey | CNRBWNZKYXUJIR-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|