C19H21F3O2S — CID 141140640
1-methyl-3-[2-[[4-(trifluoromethoxy)phenoxy]methyl]butylsulfanyl]benzene (PubChem CID 141140640) has the molecular formula C19H21F3O2S and a molecular weight of 370.44 g/mol. Its IUPAC name is 1-methyl-3-[2-[[4-(trifluoromethoxy)phenoxy]methyl]butylsulfanyl]benzene.
| Compound Name | 1-methyl-3-[2-[[4-(trifluoromethoxy)phenoxy]methyl]butylsulfanyl]benzene |
|---|---|
| PubChem CID | 141140640 |
| Molecular Formula | C19H21F3O2S |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 1-methyl-3-[2-[[4-(trifluoromethoxy)phenoxy]methyl]butylsulfanyl]benzene |
| SMILES | CCC(COc1ccc(OC(F)(F)F)cc1)CSc1cccc(C)c1 |
| InChI | InChI=1S/C19H21F3O2S/c1-3-15(13-25-18-6-4-5-14(2)11-18)12-23-16-7-9-17(10-8-16)24-19(20,21)22/h4-11,15H,3,12-13H2,1-2H3 |
| InChIKey | WTNYLHKMXFZDEH-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |