C18H17F3O4S — CID 68860339
4-(3-methylphenyl)sulfanyl-2-[4-(trifluoromethoxy)phenoxy]butanoic acid (PubChem CID 68860339) has the molecular formula C18H17F3O4S and a molecular weight of 386.39 g/mol. Its IUPAC name is 4-(3-methylphenyl)sulfanyl-2-[4-(trifluoromethoxy)phenoxy]butanoic acid.
| Compound Name | 4-(3-methylphenyl)sulfanyl-2-[4-(trifluoromethoxy)phenoxy]butanoic acid |
|---|---|
| PubChem CID | 68860339 |
| Molecular Formula | C18H17F3O4S |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 4-(3-methylphenyl)sulfanyl-2-[4-(trifluoromethoxy)phenoxy]butanoic acid |
| SMILES | Cc1cccc(SCCC(Oc2ccc(OC(F)(F)F)cc2)C(=O)O)c1 |
| InChI | InChI=1S/C18H17F3O4S/c1-12-3-2-4-15(11-12)26-10-9-16(17(22)23)24-13-5-7-14(8-6-13)25-18(19,20)21/h2-8,11,16H,9-10H2,1H3,(H,22,23) |
| InChIKey | XWCPFAHEXVIQGJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |