C27H24O4S — CID 11633659
2-[4-[(E)-6-hydroxy-3-(4-phenylphenyl)hex-2-en-4-ynyl]sulfanyl-2-methylphenoxy]acetic acid (PubChem CID 11633659) has the molecular formula C27H24O4S and a molecular weight of 444.55 g/mol. Its IUPAC name is 2-[4-[(E)-6-hydroxy-3-(4-phenylphenyl)hex-2-en-4-ynyl]sulfanyl-2-methylphenoxy]acetic acid.
| Compound Name | 2-[4-[(E)-6-hydroxy-3-(4-phenylphenyl)hex-2-en-4-ynyl]sulfanyl-2-methylphenoxy]acetic acid |
|---|---|
| PubChem CID | 11633659 |
| Molecular Formula | C27H24O4S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 2-[4-[(E)-6-hydroxy-3-(4-phenylphenyl)hex-2-en-4-ynyl]sulfanyl-2-methylphenoxy]acetic acid |
| SMILES | Cc1cc(SC/C=C(/C#CCO)c2ccc(-c3ccccc3)cc2)ccc1OCC(=O)O |
| InChI | InChI=1S/C27H24O4S/c1-20-18-25(13-14-26(20)31-19-27(29)30)32-17-15-22(8-5-16-28)24-11-9-23(10-12-24)21-6-3-2-4-7-21/h2-4,6-7,9-15,18,28H,16-17,19H2,1H3,(H,29,30)/b22-15- |
| InChIKey | LHFCUGLZBYJDQG-JCMHNJIXSA-N |
| XLogP | 5.30 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|