C36H40N2O3S — CID 91315230
ethyl 2-[4-[3,3-bis[4-[3-(dimethylamino)prop-1-ynyl]phenyl]prop-2-enylsulfanyl]-2-methylphenoxy]acetate (PubChem CID 91315230) has the molecular formula C36H40N2O3S and a molecular weight of 580.79 g/mol. Its IUPAC name is ethyl 2-[4-[3,3-bis[4-[3-(dimethylamino)prop-1-ynyl]phenyl]prop-2-enylsulfanyl]-2-methylphenoxy]acetate.
| Compound Name | ethyl 2-[4-[3,3-bis[4-[3-(dimethylamino)prop-1-ynyl]phenyl]prop-2-enylsulfanyl]-2-methylphenoxy]acetate |
|---|---|
| PubChem CID | 91315230 |
| Molecular Formula | C36H40N2O3S |
| Molecular Weight | 580.79 g/mol |
| Exact Mass | 580.28 |
| IUPAC Name | ethyl 2-[4-[3,3-bis[4-[3-(dimethylamino)prop-1-ynyl]phenyl]prop-2-enylsulfanyl]-2-methylphenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(SCC=C(c2ccc(C#CCN(C)C)cc2)c2ccc(C#CCN(C)C)cc2)cc1C |
| InChI | InChI=1S/C36H40N2O3S/c1-7-40-36(39)27-41-35-21-20-33(26-28(35)2)42-25-22-34(31-16-12-29(13-17-31)10-8-23-37(3)4)32-18-14-30(15-19-32)11-9-24-38(5)6/h12-22,26H,7,23-25,27H2,1-6H3 |
| InChIKey | NWSGGIGPYQSABB-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.79 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|