C29H24O3S — CID 87216981
methyl 2-[4-[3,3-bis(2-ethynylphenyl)prop-2-enylsulfanyl]-2-methylphenoxy]acetate (PubChem CID 87216981) has the molecular formula C29H24O3S and a molecular weight of 452.58 g/mol. Its IUPAC name is methyl 2-[4-[3,3-bis(2-ethynylphenyl)prop-2-enylsulfanyl]-2-methylphenoxy]acetate.
| Compound Name | methyl 2-[4-[3,3-bis(2-ethynylphenyl)prop-2-enylsulfanyl]-2-methylphenoxy]acetate |
|---|---|
| PubChem CID | 87216981 |
| Molecular Formula | C29H24O3S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | methyl 2-[4-[3,3-bis(2-ethynylphenyl)prop-2-enylsulfanyl]-2-methylphenoxy]acetate |
| SMILES | C#Cc1ccccc1C(=CCSc1ccc(OCC(=O)OC)c(C)c1)c1ccccc1C#C |
| InChI | InChI=1S/C29H24O3S/c1-5-22-11-7-9-13-25(22)27(26-14-10-8-12-23(26)6-2)17-18-33-24-15-16-28(21(3)19-24)32-20-29(30)31-4/h1-2,7-17,19H,18,20H2,3-4H3 |
| InChIKey | WNTSEHBNUOUMNA-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|