C30H26O3S — CID 10457266
2-[4-[(Z)-3-(2-methylphenyl)-3-(4-phenylphenyl)prop-2-enyl]sulfanylphenoxy]acetic acid (PubChem CID 10457266) has the molecular formula C30H26O3S and a molecular weight of 466.60 g/mol. Its IUPAC name is 2-[4-[(Z)-3-(2-methylphenyl)-3-(4-phenylphenyl)prop-2-enyl]sulfanylphenoxy]acetic acid.
| Compound Name | 2-[4-[(Z)-3-(2-methylphenyl)-3-(4-phenylphenyl)prop-2-enyl]sulfanylphenoxy]acetic acid |
|---|---|
| PubChem CID | 10457266 |
| Molecular Formula | C30H26O3S |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 2-[4-[(Z)-3-(2-methylphenyl)-3-(4-phenylphenyl)prop-2-enyl]sulfanylphenoxy]acetic acid |
| SMILES | Cc1ccccc1/C(=C\CSc1ccc(OCC(=O)O)cc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H26O3S/c1-22-7-5-6-10-28(22)29(25-13-11-24(12-14-25)23-8-3-2-4-9-23)19-20-34-27-17-15-26(16-18-27)33-21-30(31)32/h2-19H,20-21H2,1H3,(H,31,32)/b29-19- |
| InChIKey | BCZCEJJCDITRPA-CEUNXORHSA-N |
| XLogP | 7.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |