C24H21BrO3S — CID 68575449
2-[3-bromo-4-[(Z)-3-(2-methylphenyl)-3-phenylprop-2-enyl]sulfanylphenoxy]acetic acid (PubChem CID 68575449) has the molecular formula C24H21BrO3S and a molecular weight of 469.40 g/mol. Its IUPAC name is 2-[3-bromo-4-[(Z)-3-(2-methylphenyl)-3-phenylprop-2-enyl]sulfanylphenoxy]acetic acid.
| Compound Name | 2-[3-bromo-4-[(Z)-3-(2-methylphenyl)-3-phenylprop-2-enyl]sulfanylphenoxy]acetic acid |
|---|---|
| PubChem CID | 68575449 |
| Molecular Formula | C24H21BrO3S |
| Molecular Weight | 469.40 g/mol |
| Exact Mass | 468.04 |
| IUPAC Name | 2-[3-bromo-4-[(Z)-3-(2-methylphenyl)-3-phenylprop-2-enyl]sulfanylphenoxy]acetic acid |
| SMILES | Cc1ccccc1/C(=C\CSc1ccc(OCC(=O)O)cc1Br)c1ccccc1 |
| InChI | InChI=1S/C24H21BrO3S/c1-17-7-5-6-10-20(17)21(18-8-3-2-4-9-18)13-14-29-23-12-11-19(15-22(23)25)28-16-24(26)27/h2-13,15H,14,16H2,1H3,(H,26,27)/b21-13- |
| InChIKey | MADMSZRAGGEWGZ-BKUYFWCQSA-N |
| XLogP | 6.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.40 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |