C24H21FO3S — CID 68575696
2-[4-[(Z)-3-(3-fluorophenyl)-3-phenylprop-2-enyl]sulfanyl-3-methylphenoxy]acetic acid (PubChem CID 68575696) has the molecular formula C24H21FO3S and a molecular weight of 408.49 g/mol. Its IUPAC name is 2-[4-[(Z)-3-(3-fluorophenyl)-3-phenylprop-2-enyl]sulfanyl-3-methylphenoxy]acetic acid.
| Compound Name | 2-[4-[(Z)-3-(3-fluorophenyl)-3-phenylprop-2-enyl]sulfanyl-3-methylphenoxy]acetic acid |
|---|---|
| PubChem CID | 68575696 |
| Molecular Formula | C24H21FO3S |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 2-[4-[(Z)-3-(3-fluorophenyl)-3-phenylprop-2-enyl]sulfanyl-3-methylphenoxy]acetic acid |
| SMILES | Cc1cc(OCC(=O)O)ccc1SC/C=C(/c1ccccc1)c1cccc(F)c1 |
| InChI | InChI=1S/C24H21FO3S/c1-17-14-21(28-16-24(26)27)10-11-23(17)29-13-12-22(18-6-3-2-4-7-18)19-8-5-9-20(25)15-19/h2-12,14-15H,13,16H2,1H3,(H,26,27)/b22-12- |
| InChIKey | RASOEHVWHFPSMK-UUYOSTAYSA-N |
| XLogP | 5.82 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |